CymitQuimica logo

CAS 124170-34-9

:

3-(3-BROMO-4-FLUORO-PHENYL)-PROPIONALDEHYDE

Description:
3-(3-Bromo-4-fluoro-phenyl)-propionaldehyde is an organic compound characterized by its aldehyde functional group and a propionaldehyde backbone. The presence of a bromine atom and a fluorine atom on the aromatic ring significantly influences its chemical properties, including reactivity and polarity. The bromine atom, being a good leaving group, can participate in various substitution reactions, while the fluorine atom can enhance the compound's electrophilicity due to its electronegative nature. This compound is likely to exhibit moderate solubility in organic solvents and may have limited solubility in water due to the hydrophobic nature of the aromatic ring. Its structure suggests potential applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals, where halogenated compounds are often valuable intermediates. Additionally, the compound's unique substituents may impart specific biological activities, making it a candidate for further research in medicinal chemistry. Safety data should be consulted for handling and storage, as halogenated compounds can pose environmental and health risks.
Formula:C9H8BrFO
InChI:InChI=1/C9H8BrFO/c10-8-6-7(2-1-5-12)3-4-9(8)11/h3-6H,1-2H2
SMILES:C(Cc1ccc(c(c1)Br)F)C=O
Synonyms:
  • 3-(3-Brom-4-fluorphenyl)propanal
  • 3-(3-Bromo-4-Fluorophenyl)Propanal
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.