
CAS 124172-54-9
:N-Cyclopentyl-2,2,6,6-tetramethyl-4-piperidinamine
Description:
N-Cyclopentyl-2,2,6,6-tetramethyl-4-piperidinamine, with the CAS number 124172-54-9, is a chemical compound characterized by its piperidine structure, which includes a cyclopentyl group and multiple methyl substituents. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds. Its bulky structure, due to the tetramethyl groups, may influence its steric hindrance and solubility in various solvents. The presence of the cyclopentyl group can also affect its lipophilicity, potentially enhancing its ability to permeate biological membranes. N-Cyclopentyl-2,2,6,6-tetramethyl-4-piperidinamine may be of interest in medicinal chemistry and materials science due to its unique structural features, which could impart specific biological activities or functional properties. As with many organic compounds, its reactivity and stability can be influenced by environmental factors such as temperature and pH. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C14H28N2
InChI:InChI=1S/C14H28N2/c1-13(2)9-12(10-14(3,4)16-13)15-11-7-5-6-8-11/h11-12,15-16H,5-10H2,1-4H3
InChI key:InChIKey=WUWJNVZUYIEHQS-UHFFFAOYSA-N
SMILES:N(C1CC(C)(C)NC(C)(C)C1)C2CCCC2
Synonyms:- 4-Piperidinamine, N-cyclopentyl-2,2,6,6-tetramethyl-
- N-Cyclopentyl-2,2,6,6-tetramethyl-4-piperidinamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.