CAS 1241725-81-4

2-Pyridinemethanamine, 4-fluoro-, hydrochloride (1:1)

Description:

2-Pyridinemethanamine, 4-fluoro-, hydrochloride (1:1) is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a fluorine atom at the fourth position of the pyridine ring influences its reactivity and potential applications. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various chemical processes and biological applications. This compound may exhibit properties such as basicity due to the amine functional group, making it a potential candidate for use in pharmaceuticals or as an intermediate in organic synthesis. Its specific characteristics, including melting point, solubility, and stability, can vary based on environmental conditions and the presence of other substances. Safety data should be consulted to understand its handling and potential hazards, as with any chemical compound. Overall, 2-Pyridinemethanamine, 4-fluoro-, hydrochloride is of interest in both research and industrial contexts.

Formula: C₆H₇FN₂·ClH

InChI: InChI=1S/C6H7FN2.ClH/c7-5-1-2-9-6(3-5)4-8;/h1-3H,4,8H2;1H

InChI key: InChIKey=GIIXQYFOLHOJEP-UHFFFAOYSA-N

SMILES: C(N)C1=CC(F)=CC=N1.Cl

Synonyms:

• 2-Pyridinemethanamine, 4-fluoro-, hydrochloride (1:1)

(4-Fluoropyridin-2-yl)methanamine hydrochloride

CAS: 1241725-81-4

Formula: C₆H₈ClFN₂

Molecular weight: 162.5925

Ref: IN-DA000LLW

2-(Aminomethyl)-4-fluoropyridine hydrochloride

CAS: 1241725-81-4

2-(Aminomethyl)-4-fluoropyridine hydrochloride

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 162.59g/mol

Ref: 54-PC57041