CAS 1241752-30-6

5-Bromo-2-methoxy-3-(1-methylethoxy)pyridine

Description:

5-Bromo-2-methoxy-3-(1-methylethoxy)pyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 5-position and a methoxy group at the 2-position contributes to its reactivity and solubility properties. The 3-position features a branched alkoxy substituent, specifically a 1-methylethoxy group, which enhances its steric bulk and may influence its interactions in chemical reactions. This compound is likely to exhibit moderate polarity due to the presence of both polar and nonpolar functional groups, making it soluble in a variety of organic solvents. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as pyridine derivatives are often associated with biological activity. Additionally, the bromine substituent may serve as a useful handle for further chemical modifications, such as nucleophilic substitutions or coupling reactions. Overall, this compound's unique structural features position it as a versatile intermediate in organic synthesis.

Formula: C₉H₁₂BrNO₂

InChI: InChI=1S/C9H12BrNO2/c1-6(2)13-8-4-7(10)5-11-9(8)12-3/h4-6H,1-3H3

InChI key: InChIKey=PUVJBKNJKFDWPA-UHFFFAOYSA-N

SMILES: O(C(C)C)C1=C(OC)N=CC(Br)=C1

Synonyms:

• Pyridine, 5-bromo-2-methoxy-3-(1-methylethoxy)-
• 5-Bromo-2-methoxy-3-(1-methylethoxy)pyridine