CymitQuimica logo

CAS 124190-28-9

:

2-(1-carboxy-2-hydroxypropyl)-4-{[5-(dimethylcarbamoyl)pyrrolidin-3-yl]sulfanyl}-3-methyl-3,4-dihydro-2H-pyrrole-5-carboxylic acid

Description:
The chemical substance known as 2-(1-carboxy-2-hydroxypropyl)-4-{[5-(dimethylcarbamoyl)pyrrolidin-3-yl]sulfanyl}-3-methyl-3,4-dihydro-2H-pyrrole-5-carboxylic acid, with the CAS number 124190-28-9, is a complex organic compound characterized by its multi-functional groups. It features a pyrrole ring, which is a five-membered aromatic heterocycle, and incorporates both carboxylic acid and hydroxy groups, indicating potential for hydrogen bonding and solubility in polar solvents. The presence of a dimethylcarbamoyl group suggests it may exhibit specific reactivity and biological activity, potentially influencing its pharmacological properties. Additionally, the sulfanyl group indicates the presence of sulfur, which can impart unique chemical behavior, such as nucleophilicity. This compound may be of interest in medicinal chemistry due to its structural complexity and the potential for interactions with biological targets. Its synthesis and characterization would require careful consideration of its functional groups and stereochemistry to fully understand its properties and applications.
Formula:C17H27N3O6S
InChI:InChI=1/C17H27N3O6S/c1-7-12(11(8(2)21)16(23)24)19-13(17(25)26)14(7)27-9-5-10(18-6-9)15(22)20(3)4/h7-12,14,18,21H,5-6H2,1-4H3,(H,23,24)(H,25,26)
SMILES:CC1C(C(C(C)O)C(=O)O)N=C(C1SC1CC(C(=O)N(C)C)NC1)C(=O)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.