CAS 1241948-58-2: 5-Bromo-2,3-difluoro-4-(trimethylsilyl)benzoic acid

Description: 5-Bromo-2,3-difluoro-4-(trimethylsilyl)benzoic acid is an organic compound characterized by the presence of a benzoic acid moiety substituted with bromine and fluorine atoms, as well as a trimethylsilyl group. The bromine atom is located at the 5-position, while the difluoro substituents are at the 2 and 3 positions of the aromatic ring. The trimethylsilyl group, which is a silicon-containing functional group, is attached at the 4-position. This compound is typically used in organic synthesis and may serve as an intermediate in the preparation of other chemical entities. Its unique combination of halogen and silyl substituents can influence its reactivity, solubility, and overall chemical behavior. The presence of the carboxylic acid functional group contributes to its acidity and potential for forming hydrogen bonds, which can affect its interactions in various chemical environments. As with many halogenated compounds, it may exhibit specific properties such as increased lipophilicity and altered electronic characteristics, making it of interest in medicinal chemistry and materials science.

Formula: C₁₀H₁₁BrF₂O₂Si

InChI: InChI=1S/C10H11BrF2O2Si/c1-16(2,3)9-6(11)4-5(10(14)15)7(12)8(9)13/h4H,1-3H3,(H,14,15)

InChI key: InChIKey=VYWXKBGZPJDKCK-UHFFFAOYSA-N

SMILES: O=C(O)C1=CC(Br)=C(C(F)=C1F)[Si](C)(C)C

5-Bromo-2,3-difluoro-4-trimethylsilylbenzoic acid

CAS: 1241948-58-2

• Purity: 95%
• Molecular weight: 309.18g/mol

5-Bromo-2,3-difluoro-4-(trimethylsilyl)benzoic acid

CAS: 1241948-58-2

• Purity: 98%
• Molecular weight: 309.1820068359375