CAS 1242-67-7
:cannabidiol dimethyl ether
Description:
Cannabidiol dimethyl ether, with the CAS number 1242-67-7, is a derivative of cannabidiol (CBD), a non-psychoactive compound found in cannabis. This substance is characterized by its unique chemical structure, which includes a dimethyl ether functional group that alters its solubility and reactivity compared to its parent compound. Cannabidiol dimethyl ether is typically a colorless to pale yellow liquid, exhibiting low volatility and a relatively low boiling point. It is known for its potential therapeutic properties, including anti-inflammatory, analgesic, and anxiolytic effects, although research is ongoing to fully understand its pharmacological profile. The presence of the dimethyl ether group may enhance its bioavailability and stability, making it an interesting candidate for various applications in pharmaceuticals and nutraceuticals. As with many cannabinoids, the legal status and regulatory considerations surrounding its use can vary by region, necessitating careful attention to local laws and guidelines.
Formula:C23H36O3
InChI:InChI=1/C21H30O2.C2H6O/c1-5-6-7-8-16-12-19(22)21(20(23)13-16)18-11-15(4)9-10-17(18)14(2)3;1-3-2/h11-13,17-18,22-23H,2,5-10H2,1,3-4H3;1-2H3/t17-,18+;/m0./s1
Synonyms:- Benzene, 1,3-dimethoxy-2-(3-methyl-6-(1-methylethenyl)-2-cyclohexen-1-yl)-5-pentyl-, (1R-trans)-
- 1,3-dimethoxy-2-[(1R,6R)-3-methyl-6-(1-methylethenyl)cyclohex-2-en-1-yl]-5-pentylbenzene
- Cannabidiol dimethyl ether
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Cannabidiol dimethyl ether
CAS:Controlled ProductCannabidiol dimethyl ether is an analog of cannabidiol, a non-psychoactive compound found in the cannabis plant. It has been shown to induce apoptosis (programmed cell death) in human cancer cells, making it a potential anticancer agent. Cannabidiol dimethyl ether acts as a protein kinase inhibitor, which can inhibit the growth and proliferation of tumor cells. Additionally, it has been found to have inhibitory effects on caffeine and oxytocin receptors in Chinese hamster ovary cells. Its potential use as an anticancer drug warrants further research and investigation.Formula:C23H34O2Purity:Min. 95%Molecular weight:342.5 g/mol
