CAS 1242015-07-1
:1-[2-(4-Bromophenoxy)-5-chlorophenyl]ethanone
Description:
1-[2-(4-Bromophenoxy)-5-chlorophenyl]ethanone is an organic compound characterized by its complex structure, which includes a ketone functional group and multiple aromatic rings. The presence of bromine and chlorine substituents on the phenyl rings contributes to its unique chemical properties, such as increased reactivity and potential biological activity. This compound is likely to exhibit moderate to high lipophilicity due to its aromatic nature, which can influence its solubility in organic solvents. The bromine and chlorine atoms can also affect the compound's electronic properties, potentially making it a candidate for various applications in pharmaceuticals or agrochemicals. Additionally, the presence of the ether linkage (phenoxy group) may enhance its stability and reactivity in certain chemical reactions. Overall, 1-[2-(4-Bromophenoxy)-5-chlorophenyl]ethanone is a compound of interest in synthetic organic chemistry, with potential implications in medicinal chemistry and material science.
Formula:C14H10BrClO2
InChI:InChI=1S/C14H10BrClO2/c1-9(17)13-8-11(16)4-7-14(13)18-12-5-2-10(15)3-6-12/h2-8H,1H3
InChI key:InChIKey=PRVLNXDENKDNKS-UHFFFAOYSA-N
SMILES:O(C1=C(C(C)=O)C=C(Cl)C=C1)C2=CC=C(Br)C=C2
Synonyms:- 1-[2-(4-Bromophenoxy)-5-chlorophenyl]ethanone
- Ethanone, 1-[2-(4-bromophenoxy)-5-chlorophenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.