CAS 1242015-23-1

Ethyl 3-(4-bromophenyl)-1H-pyrazole-4-carboxylate

Description:

Ethyl 3-(4-bromophenyl)-1H-pyrazole-4-carboxylate is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two adjacent nitrogen atoms. The presence of the ethyl ester group contributes to its solubility and reactivity, making it a versatile intermediate in organic synthesis. The 4-bromophenyl substituent enhances its biological activity and may influence its interaction with various biological targets. This compound is typically used in medicinal chemistry and research, particularly in the development of pharmaceuticals due to its potential anti-inflammatory and analgesic properties. Its molecular structure allows for various functionalizations, making it a valuable building block in the synthesis of more complex molecules. Additionally, the presence of bromine in the aromatic ring can facilitate further chemical reactions, such as nucleophilic substitutions. Overall, Ethyl 3-(4-bromophenyl)-1H-pyrazole-4-carboxylate is notable for its unique structural features and potential applications in drug discovery and development.

Formula: C₁₂H₁₁BrN₂O₂

InChI: InChI=1S/C12H11BrN2O2/c1-2-17-12(16)10-7-14-15-11(10)8-3-5-9(13)6-4-8/h3-7H,2H2,1H3,(H,14,15)

InChI key: InChIKey=VSBVIVNPNDWZJQ-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C=1C(=NNC1)C2=CC=C(Br)C=C2

Synonyms:

• 1H-Pyrazole-4-carboxylic acid, 3-(4-bromophenyl)-, ethyl ester
• Ethyl 3-(4-bromophenyl)-1H-pyrazole-4-carboxylate

ethyl 5-(4-bromophenyl)-1H-pyrazole-4-carboxylate

CAS: 1242015-23-1

Formula: C₁₂H₁₁BrN₂O₂

Purity: 95.0%

Molecular weight: 295.136

Ref: 10-F525911