CymitQuimica logo

CAS 124208-72-6

:

[4-(2-methoxybenzoyl)phenyl] acetate

Description:
[4-(2-Methoxybenzoyl)phenyl] acetate, with the CAS number 124208-72-6, is an organic compound characterized by its aromatic structure and functional groups. It features a phenyl ring substituted with an acetate group and a methoxybenzoyl moiety, which contributes to its potential applications in various fields, including pharmaceuticals and materials science. The presence of the methoxy group enhances its solubility in organic solvents, while the acetate group may influence its reactivity and interaction with biological systems. This compound is likely to exhibit moderate to high stability under standard conditions, although specific stability can depend on environmental factors such as temperature and pH. Its molecular structure suggests potential for engaging in hydrogen bonding and π-π stacking interactions, which can affect its physical properties, such as melting point and boiling point. Additionally, the compound may possess unique optical properties due to its conjugated system, making it of interest for applications in organic electronics or as a dye. Overall, [4-(2-methoxybenzoyl)phenyl] acetate is a versatile compound with diverse chemical characteristics.
Formula:C16H14O4
InChI:InChI=1/C16H14O4/c1-11(17)20-13-9-7-12(8-10-13)16(18)14-5-3-4-6-15(14)19-2/h3-10H,1-2H3
SMILES:CC(=O)Oc1ccc(cc1)C(=O)c1ccccc1OC
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.