CAS 1242137-17-2
:4-[3-[4-Cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-2,4-dioxo-1-imidazolidinyl]-2-fluorobenzamide
Description:
4-[3-[4-Cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-2,4-dioxo-1-imidazolidinyl]-2-fluorobenzamide is a complex organic compound characterized by its unique structural features, including a fluorobenzamide moiety and an imidazolidinone ring. The presence of a cyano group and trifluoromethyl substituents contributes to its potential reactivity and lipophilicity, which may influence its biological activity and solubility. This compound is likely to exhibit specific interactions with biological targets due to its functional groups, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of compounds with anti-inflammatory or anticancer properties. The presence of multiple functional groups also indicates that it may undergo various chemical reactions, including nucleophilic substitutions or electrophilic additions. Overall, this compound represents a class of synthetic organic molecules that can be tailored for specific therapeutic applications based on their chemical properties and biological interactions.
Formula:C20H14F4N4O3
InChI:InChI=1S/C20H14F4N4O3/c1-19(2)17(30)27(11-4-3-10(9-25)14(7-11)20(22,23)24)18(31)28(19)12-5-6-13(16(26)29)15(21)8-12/h3-8H,1-2H3,(H2,26,29)
InChI key:InChIKey=YFFJYEGEYBPFEX-UHFFFAOYSA-N
SMILES:O=C1N(C(C)(C)C(=O)N1C2=CC(C(F)(F)F)=C(C#N)C=C2)C3=CC(F)=C(C(N)=O)C=C3
Synonyms:- 4-[3-[4-Cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-2,4-dioxo-1-imidazolidinyl]-2-fluorobenzamide
- Benzamide, 4-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-2,4-dioxo-1-imidazolidinyl]-2-fluoro-
- Enzalutamide Impurity 17
- Enzalutamide Impurity 3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
