CAS 1242137-21-8
:N-[4-(Aminocarbonyl)-3-fluorophenyl]-2-methylalanine methyl ester
Description:
N-[4-(Aminocarbonyl)-3-fluorophenyl]-2-methylalanine methyl ester, with the CAS number 1242137-21-8, is an organic compound characterized by its amino acid structure, which includes a fluorophenyl group and a methyl ester functional group. This compound features a carbonyl group attached to the amino group, indicating its potential as a derivative of aspartic acid or similar amino acids. The presence of the fluorine atom suggests that it may exhibit unique electronic properties, potentially influencing its reactivity and interactions in biological systems. The methyl ester group enhances its lipophilicity, which can affect its solubility and permeability in biological membranes. Such compounds are often studied for their potential applications in pharmaceuticals, particularly in drug design and development, due to their ability to mimic natural amino acids while providing additional functional properties. Overall, this compound's structural characteristics suggest it may play a role in various biochemical processes or serve as a lead compound in medicinal chemistry research.
Formula:C12H15FN2O3
InChI:InChI=1S/C12H15FN2O3/c1-12(2,11(17)18-3)15-7-4-5-8(10(14)16)9(13)6-7/h4-6,15H,1-3H3,(H2,14,16)
InChI key:InChIKey=RKZPPQSTEMLROE-UHFFFAOYSA-N
SMILES:C(N)(=O)C1=C(F)C=C(NC(C(OC)=O)(C)C)C=C1
Synonyms:- N-[4-(Aminocarbonyl)-3-fluorophenyl]-2-methylalanine methyl ester
- Alanine, N-[4-(aminocarbonyl)-3-fluorophenyl]-2-methyl-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Alanine, N-[4-(aminocarbonyl)-3-fluorophenyl]-2-methyl-, methyl ester
CAS:Formula:C24H36O2Color and Shape:SolidMolecular weight:356.5414N-[4-(Aminocarbonyl)-3-fluorophenyl]-2-methylalanine Methyl Ester
CAS:Controlled ProductFormula:C12H15FN2O3Color and Shape:NeatMolecular weight:254.26

