
CAS 124215-47-0
:2-(3-Chloropropyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Description:
2-(3-Chloropropyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is an organoboron compound characterized by its unique dioxaborolane ring structure, which features two boron atoms and a five-membered cyclic arrangement. This compound contains a chloropropyl substituent, which enhances its reactivity and potential applications in organic synthesis. The presence of tetramethyl groups contributes to its steric bulk, influencing its chemical behavior and solubility. Typically, compounds of this nature are utilized in various chemical reactions, including cross-coupling reactions, due to the reactivity of the boron atom. The chloropropyl group can serve as a leaving group, facilitating nucleophilic substitution reactions. Additionally, the compound may exhibit specific physical properties such as volatility and solubility in organic solvents, which are essential for its handling and application in laboratory settings. Overall, 2-(3-Chloropropyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is a versatile intermediate in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals.
Formula:C9H18BClO2
InChI:InChI=1S/C9H18BClO2/c1-8(2)9(3,4)13-10(12-8)6-5-7-11/h5-7H2,1-4H3
InChI key:InChIKey=XIXOLVRLUCUKQE-UHFFFAOYSA-N
SMILES:CC1(C)C(C)(C)OB(CCCCl)O1
Synonyms:- 1,3,2-Dioxaborolane, 2-(3-chloropropyl)-4,4,5,5-tetramethyl-
- 2-(3-Chloropropyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,3,2-Dioxaborolane, 2-(3-chloropropyl)-4,4,5,5-tetramethyl-
CAS:Formula:C9H18BClO2Molecular weight:204.5020
