
CAS 1242152-62-0
:5-[(4-Methoxyphenyl)methoxy]-1H-indazol-3-amine
Description:
5-[(4-Methoxyphenyl)methoxy]-1H-indazol-3-amine is a chemical compound characterized by its indazole core, which is a five-membered heterocyclic structure containing two nitrogen atoms. The compound features a methoxy group attached to a phenyl ring, contributing to its aromatic properties and potentially influencing its solubility and reactivity. The presence of the amine functional group indicates that it can participate in hydrogen bonding, which may enhance its biological activity. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the specific arrangement of substituents on the indazole ring may affect its electronic properties and overall stability. As with many organic compounds, its behavior in various solvents and under different conditions can vary, making it essential to consider these factors in experimental settings. Overall, this compound represents a unique structure that could be valuable in research and development within the field of pharmaceuticals.
Formula:C15H15N3O2
InChI:InChI=1S/C15H15N3O2/c1-19-11-4-2-10(3-5-11)9-20-12-6-7-14-13(8-12)15(16)18-17-14/h2-8H,9H2,1H3,(H3,16,17,18)
InChI key:InChIKey=CEDTZVIHIUIOFX-UHFFFAOYSA-N
SMILES:NC=1C=2C(=CC=C(OCC3=CC=C(OC)C=C3)C2)NN1
Synonyms:- 5-[(4-Methoxyphenyl)methoxy]-1H-indazol-3-amine
- 1H-Indazol-3-amine, 5-[(4-methoxyphenyl)methoxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
