CymitQuimica logo

CAS 1242240-90-9

:

2-Chloro-6-[2-(1-pyrrolidinyl)ethoxy]pyrazine

Description:
2-Chloro-6-[2-(1-pyrrolidinyl)ethoxy]pyrazine is a chemical compound characterized by its pyrazine core, which is a six-membered aromatic ring containing two nitrogen atoms. The presence of a chloro substituent at the 2-position and an ethoxy group linked to a pyrrolidine moiety at the 6-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents due to its polar functional groups. It is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, owing to the presence of the pyrrolidine ring, which is known for its biological activity. The compound's structure suggests it may interact with various biological targets, making it of interest in drug discovery. Safety and handling precautions should be observed, as with many halogenated compounds, due to potential toxicity and environmental concerns.
Formula:C10H14ClN3O
InChI:InChI=1S/C10H14ClN3O/c11-9-7-12-8-10(13-9)15-6-5-14-3-1-2-4-14/h7-8H,1-6H2
InChI key:InChIKey=YCTXOVQPGATDBV-UHFFFAOYSA-N
SMILES:O(CCN1CCCC1)C2=NC(Cl)=CN=C2
Synonyms:
  • 2-Chloro-6-[2-(1-pyrrolidinyl)ethoxy]pyrazine
  • Pyrazine, 2-chloro-6-[2-(1-pyrrolidinyl)ethoxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.