CymitQuimica logo

CAS 1242240-99-8

:

6-Chloro-N-tricyclo[3.3.1.13,7]dec-1-yl-4-pyrimidinamine

Description:
6-Chloro-N-tricyclo[3.3.1.1^3,7]dec-1-yl-4-pyrimidinamine is a chemical compound characterized by its unique bicyclic structure, which incorporates a tricyclic decane framework and a pyrimidine ring. The presence of a chlorine atom at the 6-position of the pyrimidine contributes to its reactivity and potential biological activity. This compound is typically classified as a heterocyclic amine due to the nitrogen atoms in the pyrimidine ring. Its structural complexity may influence its solubility, stability, and interaction with biological targets, making it of interest in medicinal chemistry and drug development. The specific arrangement of atoms and functional groups can affect its pharmacokinetic properties, including absorption, distribution, metabolism, and excretion (ADME). Additionally, the compound may exhibit specific binding affinities to certain receptors or enzymes, which could be explored for therapeutic applications. As with many synthetic compounds, safety and toxicity profiles would need to be evaluated through rigorous testing to determine its suitability for use in pharmaceuticals or other applications.
Formula:C14H18ClN3
InChI:InChI=1S/C14H18ClN3/c15-12-4-13(17-8-16-12)18-14-5-9-1-10(6-14)3-11(2-9)7-14/h4,8-11H,1-3,5-7H2,(H,16,17,18)
InChI key:InChIKey=LPSXOVAWXMPQAL-UHFFFAOYSA-N
SMILES:N(C12CC3CC(C1)CC(C2)C3)C=4C=C(Cl)N=CN4
Synonyms:
  • 4-Pyrimidinamine, 6-chloro-N-tricyclo[3.3.1.13,7]dec-1-yl-
  • 6-Chloro-N-tricyclo[3.3.1.13,7]dec-1-yl-4-pyrimidinamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.