
CAS 1242260-18-9
:Ethyl 4-bromo-7-fluoro-3-quinolinecarboxylate
Description:
Ethyl 4-bromo-7-fluoro-3-quinolinecarboxylate is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features a carboxylate functional group, which contributes to its reactivity and solubility properties. The presence of bromine and fluorine substituents on the quinoline ring enhances its biological activity and can influence its pharmacological properties. Typically, compounds like this are of interest in medicinal chemistry due to their potential applications in drug development, particularly in targeting specific biological pathways. The ethyl ester group indicates that it can undergo hydrolysis to yield the corresponding carboxylic acid, which may further participate in various chemical reactions. Additionally, the compound's molecular structure suggests it may exhibit unique electronic properties, making it suitable for studies in materials science or as a ligand in coordination chemistry. Overall, Ethyl 4-bromo-7-fluoro-3-quinolinecarboxylate is a versatile compound with potential applications across various fields of chemistry and pharmacology.
Formula:C12H9BrFNO2
InChI:InChI=1S/C12H9BrFNO2/c1-2-17-12(16)9-6-15-10-5-7(14)3-4-8(10)11(9)13/h3-6H,2H2,1H3
InChI key:InChIKey=VAQJPFPPRDOPLT-UHFFFAOYSA-N
SMILES:BrC=1C2=C(N=CC1C(OCC)=O)C=C(F)C=C2
Synonyms:- Ethyl 4-bromo-7-fluoro-3-quinolinecarboxylate
- 3-Quinolinecarboxylic acid, 4-bromo-7-fluoro-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.