
CAS 1242260-40-7
:4-Amino-7-fluoro-3-quinolinecarboxylic acid
Description:
4-Amino-7-fluoro-3-quinolinecarboxylic acid is a chemical compound characterized by its quinoline structure, which features a fused bicyclic aromatic system. This compound contains an amino group (-NH2) and a carboxylic acid group (-COOH), contributing to its potential as a biologically active molecule. The presence of a fluorine atom at the 7-position enhances its lipophilicity and may influence its pharmacological properties. The compound is likely to exhibit properties typical of amino acids and carboxylic acids, such as solubility in polar solvents and the ability to participate in hydrogen bonding. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of antimicrobial or anti-inflammatory agents. Additionally, the unique combination of functional groups may allow for further derivatization, expanding its utility in various chemical reactions. As with many quinoline derivatives, it may also exhibit fluorescence, making it useful in analytical applications. However, specific biological activity and toxicity profiles would require further investigation through experimental studies.
Formula:C10H7FN2O2
InChI:InChI=1S/C10H7FN2O2/c11-5-1-2-6-8(3-5)13-4-7(9(6)12)10(14)15/h1-4H,(H2,12,13)(H,14,15)
InChI key:InChIKey=NWWNOKZSLAWADK-UHFFFAOYSA-N
SMILES:NC=1C2=C(N=CC1C(O)=O)C=C(F)C=C2
Synonyms:- 4-Amino-7-fluoroquinoline-3-carboxylic acid
- 3-Quinolinecarboxylic acid, 4-amino-7-fluoro-
- 4-Amino-7-fluoro-3-quinolinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
