
CAS 1242260-52-1
:Ethyl 4,7-dibromo-8-methyl-3-quinolinecarboxylate
Description:
Ethyl 4,7-dibromo-8-methyl-3-quinolinecarboxylate is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom in the ring. This substance features two bromine substituents at the 4 and 7 positions and a methyl group at the 8 position, contributing to its unique reactivity and potential applications in organic synthesis and medicinal chemistry. The ethyl ester functional group enhances its solubility in organic solvents, making it suitable for various chemical reactions. The presence of bromine atoms can also facilitate electrophilic substitution reactions, while the quinoline moiety is known for its biological activity, including antimicrobial and antitumor properties. This compound may be of interest in the development of pharmaceuticals or agrochemicals. As with many brominated compounds, it is essential to consider environmental and safety aspects during handling and disposal, given the potential for bioaccumulation and toxicity associated with halogenated organic compounds.
Formula:C13H11Br2NO2
InChI:InChI=1S/C13H11Br2NO2/c1-3-18-13(17)9-6-16-12-7(2)10(14)5-4-8(12)11(9)15/h4-6H,3H2,1-2H3
InChI key:InChIKey=YTSUFUXOMXJLJA-UHFFFAOYSA-N
SMILES:BrC=1C2=C(C(C)=C(Br)C=C2)N=CC1C(OCC)=O
Synonyms:- 3-Quinolinecarboxylic acid, 4,7-dibromo-8-methyl-, ethyl ester
- Ethyl 4,7-dibromo-8-methyl-3-quinolinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
