CAS 1242260-53-2

4-Amino-6-ethyl-3-quinolinecarboxylic acid

Description:

4-Amino-6-ethyl-3-quinolinecarboxylic acid is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom in the ring. This substance features an amino group (-NH2) and a carboxylic acid group (-COOH), contributing to its potential as a biologically active molecule. The presence of the ethyl group at the 6-position of the quinoline ring influences its solubility and reactivity. Typically, compounds of this nature may exhibit various biological activities, including antimicrobial or anti-inflammatory properties, making them of interest in pharmaceutical research. The compound's molecular structure allows for potential interactions with biological targets, which can be explored for therapeutic applications. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, including purification methods such as recrystallization or chromatography. As with many organic compounds, safety and handling precautions are essential due to potential toxicity or reactivity.

Formula: C₁₂H₁₂N₂O₂

InChI: InChI=1S/C12H12N2O2/c1-2-7-3-4-10-8(5-7)11(13)9(6-14-10)12(15)16/h3-6H,2H2,1H3,(H2,13,14)(H,15,16)

InChI key: InChIKey=REBGQANCUHTUMH-UHFFFAOYSA-N

SMILES: NC=1C2=C(N=CC1C(O)=O)C=CC(CC)=C2

Synonyms:

• 3-Quinolinecarboxylic acid, 4-amino-6-ethyl-
• 4-Amino-6-ethyl-3-quinolinecarboxylic acid

4-Amino-6-ethylquinoline-3-carboxylic acid

CAS: 1242260-53-2

4-Amino-6-ethylquinoline-3-carboxylic acid

Purity: 97%

Molecular weight: 216.24g/mol

Ref: 54-OR1057126