
CAS 1242260-54-3
:4-Amino-6-ethoxy-3-quinolinecarboxylic acid
Description:
4-Amino-6-ethoxy-3-quinolinecarboxylic acid is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features an amino group (-NH2) and an ethoxy group (-OCH2CH3) attached to the quinoline ring, as well as a carboxylic acid functional group (-COOH) that contributes to its acidic properties. The presence of these functional groups suggests that the compound may exhibit both basic and acidic behavior, making it potentially useful in various chemical reactions and applications. Its molecular structure allows for potential interactions with biological systems, indicating possible pharmaceutical relevance. The compound may also display solubility in organic solvents due to the ethoxy group, while the carboxylic acid moiety could enhance its solubility in polar solvents. Overall, 4-Amino-6-ethoxy-3-quinolinecarboxylic acid is of interest in medicinal chemistry and may serve as a precursor or intermediate in the synthesis of other bioactive compounds.
Formula:C12H12N2O3
InChI:InChI=1S/C12H12N2O3/c1-2-17-7-3-4-10-8(5-7)11(13)9(6-14-10)12(15)16/h3-6H,2H2,1H3,(H2,13,14)(H,15,16)
InChI key:InChIKey=PSQRDNKPZFJUCE-UHFFFAOYSA-N
SMILES:NC=1C2=C(N=CC1C(O)=O)C=CC(OCC)=C2
Synonyms:- 4-Amino-6-ethoxyquinoline-3-carboxylic acid
- 3-Quinolinecarboxylic acid, 4-amino-6-ethoxy-
- 4-Amino-6-ethoxy-3-quinolinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
