CAS 1242260-58-7

4-Amino-8-bromo-3-quinolinecarboxylic acid

Description:

4-Amino-8-bromo-3-quinolinecarboxylic acid is a chemical compound characterized by its quinoline structure, which features a nitrogen-containing bicyclic aromatic system. This compound contains an amino group (-NH2) and a bromo substituent, which contribute to its reactivity and potential applications in medicinal chemistry. The carboxylic acid functional group (-COOH) enhances its solubility in polar solvents and allows for potential interactions in biological systems. The presence of the bromine atom can influence the compound's electronic properties and may enhance its biological activity. Typically, compounds of this nature are investigated for their potential as pharmaceuticals, particularly in the development of antimicrobial or anticancer agents. The specific arrangement of functional groups in 4-amino-8-bromo-3-quinolinecarboxylic acid suggests that it may participate in hydrogen bonding and other intermolecular interactions, which are crucial for its biological efficacy. Overall, this compound represents a class of heterocyclic compounds that are of significant interest in organic synthesis and drug discovery.

Formula: C₁₀H₇BrN₂O₂

InChI: InChI=1S/C10H7BrN2O2/c11-7-3-1-2-5-8(12)6(10(14)15)4-13-9(5)7/h1-4H,(H2,12,13)(H,14,15)

InChI key: InChIKey=WUNUCIAEGKMVOE-UHFFFAOYSA-N

SMILES: NC=1C2=C(N=CC1C(O)=O)C(Br)=CC=C2

Synonyms:

• 3-Quinolinecarboxylic acid, 4-amino-8-bromo-
• 4-Amino-8-bromo-3-quinolinecarboxylic acid