
CAS 1242260-66-7
:Ethyl 4-amino-5-chloro-8-methoxy-3-quinolinecarboxylate
Description:
Ethyl 4-amino-5-chloro-8-methoxy-3-quinolinecarboxylate is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features an ethyl ester functional group, contributing to its solubility and reactivity. The presence of an amino group and a chloro substituent indicates potential for various chemical reactions, including nucleophilic substitutions and coupling reactions. The methoxy group enhances its lipophilicity, which may influence its biological activity and pharmacokinetics. This compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, as quinoline derivatives are known for their diverse biological activities, including antimicrobial and antimalarial properties. Its specific properties, such as melting point, boiling point, and spectral characteristics, would typically be determined through experimental methods. As with many chemical substances, safety data and handling precautions are essential, especially considering the presence of chlorine and nitrogen functionalities, which may pose health risks if not managed properly.
Formula:C13H13ClN2O3
InChI:InChI=1S/C13H13ClN2O3/c1-3-19-13(17)7-6-16-12-9(18-2)5-4-8(14)10(12)11(7)15/h4-6H,3H2,1-2H3,(H2,15,16)
InChI key:InChIKey=UAXVRQDDUIKGSM-UHFFFAOYSA-N
SMILES:NC=1C2=C(C(OC)=CC=C2Cl)N=CC1C(OCC)=O
Synonyms:- Ethyl 4-amino-5-chloro-8-methoxy-3-quinolinecarboxylate
- 3-Quinolinecarboxylic acid, 4-amino-5-chloro-8-methoxy-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.