
CAS 1242260-75-8
:Ethyl 4-bromo-5-chloro-8-methyl-3-quinolinecarboxylate
Description:
Ethyl 4-bromo-5-chloro-8-methyl-3-quinolinecarboxylate is a synthetic organic compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features a carboxylate functional group, indicating it is an ester, specifically an ethyl ester, which contributes to its solubility in organic solvents. The presence of bromine and chlorine substituents on the quinoline ring enhances its reactivity and may influence its biological activity, making it of interest in medicinal chemistry. The methyl group at the 8-position adds to the compound's steric properties. Typically, compounds like this may exhibit various pharmacological activities, including antimicrobial or anticancer properties, due to their complex structure and functional groups. Its specific applications and behavior in chemical reactions would depend on the context of its use, including potential interactions with biological targets or other chemical species. As with many halogenated compounds, safety considerations regarding toxicity and environmental impact are also important.
Formula:C13H11BrClNO2
InChI:InChI=1S/C13H11BrClNO2/c1-3-18-13(17)8-6-16-12-7(2)4-5-9(15)10(12)11(8)14/h4-6H,3H2,1-2H3
InChI key:InChIKey=WBDGBSRIARFQDY-UHFFFAOYSA-N
SMILES:BrC=1C2=C(N=CC1C(OCC)=O)C(C)=CC=C2Cl
Synonyms:- Ethyl 4-bromo-5-chloro-8-methyl-3-quinolinecarboxylate
- 3-Quinolinecarboxylic acid, 4-bromo-5-chloro-8-methyl-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.