CAS 1242260-76-9

Ethyl 4-amino-6-ethyl-3-quinolinecarboxylate

Description:

Ethyl 4-amino-6-ethyl-3-quinolinecarboxylate is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom in the ring. This substance features an ethyl group at the 6-position and an amino group at the 4-position, contributing to its potential biological activity. The carboxylate functional group indicates that it can participate in various chemical reactions, including esterification and amidation. Ethyl 4-amino-6-ethyl-3-quinolinecarboxylate may exhibit properties such as solubility in organic solvents, moderate stability under standard conditions, and potential reactivity due to the presence of the amino and carboxylate groups. Its unique structure suggests possible applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. However, detailed studies on its toxicity, pharmacokinetics, and specific applications would be necessary to fully understand its characteristics and potential uses.

Formula: C₁₄H₁₆N₂O₂

InChI: InChI=1S/C14H16N2O2/c1-3-9-5-6-12-10(7-9)13(15)11(8-16-12)14(17)18-4-2/h5-8H,3-4H2,1-2H3,(H2,15,16)

InChI key: InChIKey=ISTCOANWTFQKMB-UHFFFAOYSA-N

SMILES: NC=1C2=C(N=CC1C(OCC)=O)C=CC(CC)=C2

Synonyms:

• 3-Quinolinecarboxylic acid, 4-amino-6-ethyl-, ethyl ester
• Ethyl 4-amino-6-ethyl-3-quinolinecarboxylate