CymitQuimica logo

CAS 1242260-83-8

:

Ethyl 4-bromo-8-methyl-3-quinolinecarboxylate

Description:
Ethyl 4-bromo-8-methyl-3-quinolinecarboxylate is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom in the ring. This substance features a bromine atom at the 4-position and a methyl group at the 8-position of the quinoline ring, contributing to its unique reactivity and properties. The ethyl ester functional group at the 3-position enhances its solubility in organic solvents and may influence its biological activity. Typically, compounds of this nature are of interest in medicinal chemistry due to their potential pharmacological properties, including antimicrobial and anticancer activities. The presence of the bromine atom can also facilitate further chemical modifications, making it a versatile intermediate in synthetic organic chemistry. Additionally, the compound's molecular structure suggests it may exhibit specific interactions with biological targets, warranting further investigation into its potential applications in drug development. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C13H12BrNO2
InChI:InChI=1S/C13H12BrNO2/c1-3-17-13(16)10-7-15-12-8(2)5-4-6-9(12)11(10)14/h4-7H,3H2,1-2H3
InChI key:InChIKey=VENYPKCPQATINN-UHFFFAOYSA-N
SMILES:BrC=1C2=C(N=CC1C(OCC)=O)C(C)=CC=C2
Synonyms:
  • Ethyl 4-bromo-8-methyl-3-quinolinecarboxylate
  • 3-Quinolinecarboxylic acid, 4-bromo-8-methyl-, ethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.