CAS 1242260-84-9

Ethyl 4-bromo-7-chloro-8-methyl-3-quinolinecarboxylate

Description:

Ethyl 4-bromo-7-chloro-8-methyl-3-quinolinecarboxylate is a synthetic organic compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom in the ring. This substance features a carboxylate functional group, which contributes to its reactivity and solubility properties. The presence of bromine and chlorine substituents on the quinoline ring enhances its potential for various chemical reactions, including electrophilic aromatic substitution. The ethyl ester group provides additional solubility in organic solvents and may influence its biological activity. This compound is of interest in medicinal chemistry and materials science due to its potential applications in drug development and as a building block for more complex molecules. Its unique combination of halogen substituents and the carboxylate moiety may also impart specific pharmacological properties, making it a candidate for further research in therapeutic applications. As with many synthetic compounds, safety and handling precautions should be observed due to potential toxicity and environmental impact.

Formula: C₁₃H₁₁BrClNO₂

InChI: InChI=1S/C13H11BrClNO2/c1-3-18-13(17)9-6-16-12-7(2)10(15)5-4-8(12)11(9)14/h4-6H,3H2,1-2H3

InChI key: InChIKey=MGJMOARTVXTELR-UHFFFAOYSA-N

SMILES: BrC=1C2=C(C(C)=C(Cl)C=C2)N=CC1C(OCC)=O

Synonyms:

• Ethyl 4-bromo-7-chloro-8-methyl-3-quinolinecarboxylate
• 3-Quinolinecarboxylic acid, 4-bromo-7-chloro-8-methyl-, ethyl ester