
CAS 1242267-81-7
:1,4-Bis(1,1-dimethylethyl) (2R)-2-(cyanomethyl)-1,4-piperazinedicarboxylate
Description:
1,4-Bis(1,1-dimethylethyl) (2R)-2-(cyanomethyl)-1,4-piperazinedicarboxylate is a synthetic organic compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features two carboxylate groups, contributing to its potential as a versatile building block in organic synthesis. The presence of the cyanomethyl group indicates that it may participate in nucleophilic reactions, making it useful in various chemical transformations. The tert-butyl groups (1,1-dimethylethyl) enhance the compound's lipophilicity, potentially influencing its solubility and reactivity in biological systems. The specific stereochemistry at the 2-position (2R) suggests that the compound may exhibit chiral properties, which can affect its interaction with biological targets. Overall, this compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that allow for diverse functionalization and reactivity. However, detailed studies would be necessary to fully understand its properties and potential applications.
Formula:C16H27N3O4
InChI:InChI=1S/C16H27N3O4/c1-15(2,3)22-13(20)18-9-10-19(12(11-18)7-8-17)14(21)23-16(4,5)6/h12H,7,9-11H2,1-6H3/t12-/m1/s1
InChI key:InChIKey=OCFZRXVLIYTIRX-GFCCVEGCSA-N
SMILES:C(C#N)[C@H]1N(C(OC(C)(C)C)=O)CCN(C(OC(C)(C)C)=O)C1
Synonyms:- 1,4-Bis(1,1-dimethylethyl) (2R)-2-(cyanomethyl)-1,4-piperazinedicarboxylate
- 1,4-Piperazinedicarboxylic acid, 2-(cyanomethyl)-, 1,4-bis(1,1-dimethylethyl) ester, (2R)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.