CymitQuimica logo

CAS 1242267-84-0

:

1,2-Dihydro-4-(trifluoromethyl)-3H-pyrazolo[3,4-b]pyridin-3-one

Description:
1,2-Dihydro-4-(trifluoromethyl)-3H-pyrazolo[3,4-b]pyridin-3-one is a heterocyclic organic compound characterized by its unique pyrazolo-pyridine structure. This compound features a trifluoromethyl group, which significantly influences its chemical reactivity and physical properties, often enhancing lipophilicity and biological activity. The presence of the pyrazole ring contributes to its potential as a pharmacophore in medicinal chemistry, making it of interest in drug development. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential applications in various fields, including agrochemicals and pharmaceuticals, particularly due to the trifluoromethyl group, which is known to improve metabolic stability and bioavailability. Additionally, the compound's reactivity can be influenced by the presence of functional groups, making it a candidate for further chemical modifications. Overall, 1,2-Dihydro-4-(trifluoromethyl)-3H-pyrazolo[3,4-b]pyridin-3-one represents a versatile scaffold in organic synthesis and medicinal chemistry.
Formula:C7H4F3N3O
InChI:InChI=1S/C7H4F3N3O/c8-7(9,10)3-1-2-11-5-4(3)6(14)13-12-5/h1-2H,(H2,11,12,13,14)
InChI key:InChIKey=CDDDQKFLGSXJBO-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C2C(NNC2=O)=NC=C1
Synonyms:
  • 3H-Pyrazolo[3,4-b]pyridin-3-one, 1,2-dihydro-4-(trifluoromethyl)-
  • 1,2-Dihydro-4-(trifluoromethyl)-3H-pyrazolo[3,4-b]pyridin-3-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.