CAS 1242267-95-3

Spiro[[1,3]dioxolo[4,5-g]pyrrolo[1,2-a]quinoxaline-4(5H),4′-piperidine], hydrochloride (1:1)

Description:

Spiro[[1,3]dioxolo[4,5-g]pyrrolo[1,2-a]quinoxaline-4(5H),4′-piperidine], hydrochloride (1:1), identified by CAS number 1242267-95-3, is a complex organic compound characterized by its unique spirocyclic structure, which combines elements of dioxole, pyrrole, and quinoxaline. This compound features a piperidine moiety, contributing to its potential biological activity. The presence of the hydrochloride indicates that it is a salt form, which often enhances solubility and stability in aqueous environments. The compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its structural features suggest potential interactions with biological targets, possibly influencing various biochemical pathways. As with many synthetic organic compounds, its synthesis and characterization would involve techniques such as NMR spectroscopy, mass spectrometry, and X-ray crystallography to confirm its identity and purity. Further studies would be necessary to elucidate its specific applications and mechanisms of action in biological systems.

Formula: C₁₆H₁₇N₃O₂·ClH

InChI: InChI=1S/C16H17N3O2.ClH/c1-2-15-16(3-5-17-6-4-16)18-11-8-13-14(21-10-20-13)9-12(11)19(15)7-1;/h1-2,7-9,17-18H,3-6,10H2;1H

InChI key: InChIKey=DCGROZXCQCCEGA-UHFFFAOYSA-N

SMILES: C12(C=3N(C=4C(N1)=CC5=C(C4)OCO5)C=CC3)CCNCC2.Cl

Synonyms:

• Spiro[[1,3]dioxolo[4,5-g]pyrrolo[1,2-a]quinoxaline-4(5H),4′-piperidine], hydrochloride (1:1)