CAS 1242267-97-5

6-Cyclopropyl-1-methyl-4-(trifluoromethyl)-1H-pyrazolo[3,4-b]pyridin-3-amine

Description:

6-Cyclopropyl-1-methyl-4-(trifluoromethyl)-1H-pyrazolo[3,4-b]pyridin-3-amine is a chemical compound characterized by its complex structure, which includes a pyrazolo-pyridine core. This compound features a cyclopropyl group and a trifluoromethyl group, which contribute to its unique chemical properties and potential biological activity. The presence of the trifluoromethyl group often enhances lipophilicity and metabolic stability, making such compounds of interest in medicinal chemistry. The amine functional group can participate in hydrogen bonding, influencing solubility and reactivity. This compound may exhibit specific pharmacological properties, potentially acting as a modulator or inhibitor in various biological pathways. Its structural characteristics suggest potential applications in drug development, particularly in targeting specific receptors or enzymes. As with many compounds containing heterocycles, its synthesis and characterization would require careful consideration of reaction conditions and purification methods to ensure the desired purity and yield. Overall, 6-Cyclopropyl-1-methyl-4-(trifluoromethyl)-1H-pyrazolo[3,4-b]pyridin-3-amine represents a class of compounds that could be valuable in pharmaceutical research.

Formula: C₁₁H₁₁F₃N₄

InChI: InChI=1S/C11H11F3N4/c1-18-10-8(9(15)17-18)6(11(12,13)14)4-7(16-10)5-2-3-5/h4-5H,2-3H2,1H3,(H2,15,17)

InChI key: InChIKey=IRESGWSVTJCIGG-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=C2C(=NC(=C1)C3CC3)N(C)N=C2N

Synonyms:

• 1H-Pyrazolo[3,4-b]pyridin-3-amine, 6-cyclopropyl-1-methyl-4-(trifluoromethyl)-
• 6-Cyclopropyl-1-methyl-4-(trifluoromethyl)-1H-pyrazolo[3,4-b]pyridin-3-amine

3-Amino-6-cyclopropyl-1-methyl-4-(trifluoromethyl)-1H-pyrazolo[3,4-b]pyridine

CAS: 1242267-97-5

3-Amino-6-cyclopropyl-1-methyl-4-(trifluoromethyl)-1H-pyrazolo[3,4-b]pyridine

Molecular weight: 256.23g/mol

Ref: 54-PC200272