CymitQuimica logo

CAS 1242268-01-4

:

Methyl 6-methoxy-2-phenyl-4-pyrimidinecarboxylate

Description:
Methyl 6-methoxy-2-phenyl-4-pyrimidinecarboxylate is a chemical compound characterized by its pyrimidine core, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. This compound features a methoxy group (-OCH3) at the 6-position and a phenyl group (-C6H5) at the 2-position, contributing to its aromatic properties and potential reactivity. The carboxylate functional group, indicated by the ester linkage with a methyl group, suggests that it may participate in various chemical reactions, such as esterification or nucleophilic substitution. The presence of both aromatic and heterocyclic components may impart unique biological activities, making it of interest in medicinal chemistry. Additionally, the compound's solubility, stability, and reactivity can be influenced by the substituents on the pyrimidine ring. Overall, Methyl 6-methoxy-2-phenyl-4-pyrimidinecarboxylate is a versatile compound that may have applications in pharmaceuticals or agrochemicals, although specific biological or chemical properties would require further investigation.
Formula:C13H12N2O3
InChI:InChI=1S/C13H12N2O3/c1-17-11-8-10(13(16)18-2)14-12(15-11)9-6-4-3-5-7-9/h3-8H,1-2H3
InChI key:InChIKey=ARNMGZKALBHAPS-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=NC(=NC(OC)=C1)C2=CC=CC=C2
Synonyms:
  • Methyl 6-methoxy-2-phenyl-4-pyrimidinecarboxylate
  • 4-Pyrimidinecarboxylic acid, 6-methoxy-2-phenyl-, methyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.