CAS 1242268-06-9

Spiro[piperidine-4,4′(5′H)-pyrrolo[1,2-a]quinoxaline]-7′-carboxylic acid, methyl ester, hydrochloride (1:1)

Description:

Spiro[piperidine-4,4′(5′H)-pyrrolo[1,2-a]quinoxaline]-7′-carboxylic acid, methyl ester, hydrochloride (1:1) is a complex organic compound characterized by its unique spirocyclic structure, which incorporates both piperidine and pyrroloquinoxaline moieties. This compound typically exhibits properties associated with both basic and acidic functional groups, as indicated by the presence of a carboxylic acid derivative and a hydrochloride salt form. The methyl ester group suggests that it may have moderate lipophilicity, potentially influencing its solubility and permeability in biological systems. The hydrochloride form enhances its stability and solubility in aqueous environments, making it suitable for various applications, including medicinal chemistry and pharmacological studies. The compound's intricate structure may contribute to its biological activity, potentially interacting with specific receptors or enzymes. Overall, this substance represents a class of compounds that may have implications in drug development, particularly in targeting neurological or psychiatric disorders, although specific biological activities would require further investigation.

Formula: C₁₇H₁₉N₃O₂·ClH

InChI: InChI=1S/C17H19N3O2.ClH/c1-22-16(21)12-4-5-14-13(11-12)19-17(6-8-18-9-7-17)15-3-2-10-20(14)15;/h2-5,10-11,18-19H,6-9H2,1H3;1H

InChI key: InChIKey=AMPMYEXCPRSHAN-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1C=C2NC3(C=4N(C2=CC1)C=CC4)CCNCC3.Cl

Synonyms:

• Spiro[piperidine-4,4′(5′H)-pyrrolo[1,2-a]quinoxaline]-7′-carboxylic acid, methyl ester, hydrochloride (1:1)