CAS 1242268-13-8

Methyl 5-amino-2-[2-(1-methylethyl)-1-piperazinyl]benzoate

Description:

Methyl 5-amino-2-[2-(1-methylethyl)-1-piperazinyl]benzoate, identified by its CAS number 1242268-13-8, is a chemical compound that features a benzoate structure with an amino group and a piperazine moiety. This compound is characterized by its potential biological activity, which may include interactions with various receptors or enzymes, making it of interest in pharmaceutical research. The presence of the methyl group and the isopropyl substituent on the piperazine ring can influence its lipophilicity and solubility, affecting its pharmacokinetic properties. Additionally, the amino group can participate in hydrogen bonding, which may enhance its binding affinity to biological targets. The compound's molecular structure suggests it may exhibit specific stereochemical properties, which can be crucial for its biological function. Overall, Methyl 5-amino-2-[2-(1-methylethyl)-1-piperazinyl]benzoate represents a class of compounds that may have therapeutic potential, warranting further investigation into its efficacy and safety in medicinal applications.

Formula: C₁₅H₂₃N₃O₂

InChI: InChI=1S/C15H23N3O2/c1-10(2)14-9-17-6-7-18(14)13-5-4-11(16)8-12(13)15(19)20-3/h4-5,8,10,14,17H,6-7,9,16H2,1-3H3

InChI key: InChIKey=VTZFLRMASHDESD-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=C(C=CC(N)=C1)N2C(C(C)C)CNCC2

Synonyms:

• Methyl 5-amino-2-[2-(1-methylethyl)-1-piperazinyl]benzoate
• Benzoic acid, 5-amino-2-[2-(1-methylethyl)-1-piperazinyl]-, methyl ester