
CAS 1242268-15-0
:4-Bromo-1-(3-methoxy-4-nitrophenyl)piperidine
Description:
4-Bromo-1-(3-methoxy-4-nitrophenyl)piperidine is an organic compound characterized by its piperidine ring, which is a six-membered nitrogen-containing heterocycle. The presence of a bromine atom at the 4-position and a 3-methoxy-4-nitrophenyl group at the 1-position contributes to its unique chemical properties. This compound is likely to exhibit moderate to high lipophilicity due to the aromatic substituents, which can influence its solubility in organic solvents. The methoxy and nitro groups introduce both electron-donating and electron-withdrawing characteristics, respectively, affecting the compound's reactivity and potential interactions in biological systems. Additionally, the presence of the nitro group may impart some degree of polarity, influencing its overall behavior in chemical reactions. As a result, 4-Bromo-1-(3-methoxy-4-nitrophenyl)piperidine may be of interest in medicinal chemistry and pharmacology, particularly in the development of compounds with specific biological activities. However, detailed studies would be necessary to fully understand its properties and potential applications.
Formula:C12H15BrN2O3
InChI:InChI=1S/C12H15BrN2O3/c1-18-12-8-10(2-3-11(12)15(16)17)14-6-4-9(13)5-7-14/h2-3,8-9H,4-7H2,1H3
InChI key:InChIKey=YEIOCGHCVVIDRO-UHFFFAOYSA-N
SMILES:O(C)C=1C=C(C=CC1N(=O)=O)N2CCC(Br)CC2
Synonyms:- 4-Bromo-1-(3-methoxy-4-nitrophenyl)piperidine
- Piperidine, 4-bromo-1-(3-methoxy-4-nitrophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.