
CAS 1242268-16-1
:6-(1H-Pyrrol-1-yl)-1,3-benzodioxol-5-amine
Description:
6-(1H-Pyrrol-1-yl)-1,3-benzodioxol-5-amine is a chemical compound characterized by its unique structural features, which include a benzodioxole moiety and a pyrrole ring. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. The presence of the amine functional group suggests that it may engage in hydrogen bonding, influencing its solubility and reactivity. Additionally, the benzodioxole structure is known for its role in various pharmacological activities, potentially making this compound of interest in medicinal chemistry. Its molecular interactions may be relevant in the development of therapeutic agents, particularly in areas related to neurochemistry or as potential psychoactive substances. The compound's stability, reactivity, and interaction with biological systems would depend on its specific environment and conditions, such as pH and solvent polarity. Overall, 6-(1H-Pyrrol-1-yl)-1,3-benzodioxol-5-amine represents a fascinating subject for further research in both synthetic and applied chemistry.
Formula:C11H10N2O2
InChI:InChI=1S/C11H10N2O2/c12-8-5-10-11(15-7-14-10)6-9(8)13-3-1-2-4-13/h1-6H,7,12H2
InChI key:InChIKey=HPRMSIARSKWFEI-UHFFFAOYSA-N
SMILES:NC1=C(C=C2C(=C1)OCO2)N3C=CC=C3
Synonyms:- 6-(1H-Pyrrol-1-yl)-1,3-benzodioxol-5-amine
- 1,3-Benzodioxol-5-amine, 6-(1H-pyrrol-1-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.