CAS 1242268-30-9

6-Bromo-2-methylpyrazolo[1,5-a]pyrimidine-3-carbonitrile

Description:

6-Bromo-2-methylpyrazolo[1,5-a]pyrimidine-3-carbonitrile is a heterocyclic organic compound characterized by its unique pyrazolo-pyrimidine structure, which incorporates both bromine and cyano functional groups. This compound features a bromine atom at the 6-position and a methyl group at the 2-position of the pyrazolo ring, contributing to its chemical reactivity and potential biological activity. The presence of the cyano group at the 3-position enhances its polarity and may influence its solubility in various solvents. Typically, compounds of this class are of interest in medicinal chemistry due to their potential as pharmacological agents, particularly in the development of drugs targeting specific biological pathways. The molecular structure allows for various interactions with biological macromolecules, making it a candidate for further investigation in drug discovery. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the bromine and cyano groups, which may play a role in its synthesis and application in various chemical reactions.

Formula: C₈H₅BrN₄

InChI: InChI=1S/C8H5BrN4/c1-5-7(2-10)8-11-3-6(9)4-13(8)12-5/h3-4H,1H3

InChI key: InChIKey=GQYKYYUHNQGMLE-UHFFFAOYSA-N

SMILES: C(#N)C1=C2N(N=C1C)C=C(Br)C=N2

Synonyms:

• 6-Bromo-2-methylpyrazolo[1,5-a]pyrimidine-3-carbonitrile
• Pyrazolo[1,5-a]pyrimidine-3-carbonitrile, 6-bromo-2-methyl-

6-Bromo-2-methylpyrazolo[1,5-a]pyrimidine-3-carbonitrile

CAS: 1242268-30-9

Versatile small molecule scaffold

Formula: C₈H₅BrN₄

Purity: Min. 95%

Molecular weight: 237.06 g/mol

Ref: 3D-SZB26830