CAS 1242268-31-0

Spiro[piperidine-4,4′(5′H)-pyrrolo[1,2-a]quinoxaline], 7′-methyl-, hydrochloride (1:1)

Description:

Spiro[piperidine-4,4′(5′H)-pyrrolo[1,2-a]quinoxaline], 7′-methyl-, hydrochloride (1:1) is a complex organic compound characterized by its unique spirocyclic structure, which incorporates both piperidine and pyrroloquinoxaline moieties. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity, which may include effects on neurotransmitter systems or other pharmacological targets. The presence of the hydrochloride salt form indicates enhanced solubility in aqueous environments, making it suitable for various applications in medicinal chemistry. Its molecular structure suggests potential for interactions with biological macromolecules, which could be explored for therapeutic purposes. Additionally, the compound's synthesis and characterization would involve standard organic chemistry techniques, including spectroscopic methods for confirmation of its structure. As with many compounds in this class, safety and handling precautions are essential due to potential toxicity or reactivity. Further research would be necessary to fully elucidate its properties, mechanisms of action, and potential applications in drug development.

Formula: C₁₆H₁₉N₃·ClH

InChI: InChI=1S/C16H19N3.ClH/c1-12-4-5-14-13(11-12)18-16(6-8-17-9-7-16)15-3-2-10-19(14)15;/h2-5,10-11,17-18H,6-9H2,1H3;1H

InChI key: InChIKey=LEEMUPRBXKAFMR-UHFFFAOYSA-N

SMILES: CC=1C=C2NC3(C=4N(C2=CC1)C=CC4)CCNCC3.Cl

Synonyms:

• Spiro[piperidine-4,4′(5′H)-pyrrolo[1,2-a]quinoxaline], 7′-methyl-, hydrochloride (1:1)