CAS 1242336-54-4

5-Fluoro-3′-methyl[1,1′-biphenyl]-3-carboxylic acid

Description:

5-Fluoro-3′-methyl[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a carboxylic acid functional group (-COOH) indicates that it can act as an acid, capable of donating a proton in solution. The fluorine atom at the 5-position and the methyl group at the 3′-position on the biphenyl framework contribute to its unique chemical properties, potentially influencing its reactivity and solubility. This compound may exhibit interesting biological activity due to the presence of the fluorine atom, which can enhance lipophilicity and metabolic stability. Its molecular structure suggests potential applications in pharmaceuticals or agrochemicals, where modifications to biphenyl derivatives are often explored for improved efficacy. Additionally, the compound's characteristics, such as melting point, boiling point, and solubility, would be influenced by its functional groups and overall molecular geometry.

Formula: C₁₄H₁₁FO₂

InChI: InChI=1S/C14H11FO2/c1-9-3-2-4-10(5-9)11-6-12(14(16)17)8-13(15)7-11/h2-8H,1H3,(H,16,17)

InChI key: InChIKey=VZXUEHXYANRRFT-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=C(C=C(F)C1)C2=CC(C)=CC=C2

Synonyms:

• 5-Fluoro-3′-methyl[1,1′-biphenyl]-3-carboxylic acid
• [1,1′-Biphenyl]-3-carboxylic acid, 5-fluoro-3′-methyl-
• -methylbiphenyl-3-carboxylicacid
• 5-Fluoro-3'-methylbiphenyl-3-carboxylic acid
• 5-Fluoro-3&rsquo

5-Fluoro-3'-methylbiphenyl-3-carboxylic acid

CAS: 1242336-54-4

Formula: C₁₄H₁₁FO₂

Molecular weight: 230.2343

Ref: IN-DA000LQM