CAS 1242336-56-6
:5-Bromo-2-(cyclohexylthio)pyrimidine
Description:
5-Bromo-2-(cyclohexylthio)pyrimidine is a heterocyclic organic compound characterized by a pyrimidine ring substituted with a bromine atom and a cyclohexylthio group. The presence of the bromine atom introduces a halogen, which can enhance the compound's reactivity and influence its physical properties, such as solubility and boiling point. The cyclohexylthio group contributes to the compound's overall hydrophobic character and may affect its interactions with biological systems, making it of interest in medicinal chemistry. This compound may exhibit specific biological activities, potentially serving as a scaffold for drug development. Its molecular structure suggests that it could participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, due to the electron-withdrawing nature of the bromine and the nucleophilic potential of the thioether group. Overall, 5-Bromo-2-(cyclohexylthio)pyrimidine is a compound of interest in synthetic organic chemistry and pharmacology, warranting further investigation into its properties and applications.
Formula:C10H13BrN2S
InChI:InChI=1S/C10H13BrN2S/c11-8-6-12-10(13-7-8)14-9-4-2-1-3-5-9/h6-7,9H,1-5H2
InChI key:InChIKey=LWKBPXULGUZFPU-UHFFFAOYSA-N
SMILES:S(C=1N=CC(Br)=CN1)C2CCCCC2
Synonyms:- Pyrimidine, 5-bromo-2-(cyclohexylthio)-
- 5-Bromo-2-(cyclohexylthio)pyrimidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
