CAS 1242336-57-7

1-Bromo-4-(2-methylpropyl)-2-nitrobenzene

Description:

1-Bromo-4-(2-methylpropyl)-2-nitrobenzene is an organic compound characterized by its aromatic structure, which includes a bromine atom and a nitro group attached to a benzene ring. The presence of the 2-methylpropyl group introduces a branched alkyl substituent, contributing to the compound's hydrophobic nature. This compound is typically a yellow to brown solid at room temperature and is sparingly soluble in water, but more soluble in organic solvents such as ethanol and dichloromethane. The nitro group is a strong electron-withdrawing group, which can influence the reactivity of the compound, making it more susceptible to nucleophilic attack. Additionally, the bromine atom can serve as a leaving group in various chemical reactions, such as substitution or elimination reactions. Due to its structural features, 1-Bromo-4-(2-methylpropyl)-2-nitrobenzene may exhibit interesting properties in terms of reactivity and potential applications in organic synthesis or as an intermediate in the production of other chemical compounds. Safety precautions should be taken when handling this substance, as it may pose health risks.

Formula: C₁₀H₁₂BrNO₂

InChI: InChI=1S/C10H12BrNO2/c1-7(2)5-8-3-4-9(11)10(6-8)12(13)14/h3-4,6-7H,5H2,1-2H3

InChI key: InChIKey=DPEAEAIYPYXSLG-UHFFFAOYSA-N

SMILES: C(C(C)C)C1=CC(N(=O)=O)=C(Br)C=C1

Synonyms:

• 1-Bromo-4-(2-methylpropyl)-2-nitrobenzene
• Benzene, 1-bromo-4-(2-methylpropyl)-2-nitro-
• 1-Bromo-4-isobutyl-2-nitrobenzene

1-Bromo-4-isobutyl-2-nitrobenzene

CAS: 1242336-57-7

Formula: C₁₀H₁₂BrNO₂

Molecular weight: 258.1118

Ref: IN-DA000LQJ