CAS 1242336-60-2
:2-(1,1-Dimethylethyl)-2,3-dihydro-3-hydroxy-6-(trifluoromethyl)-1H-isoindol-1-one
Description:
2-(1,1-Dimethylethyl)-2,3-dihydro-3-hydroxy-6-(trifluoromethyl)-1H-isoindol-1-one is a chemical compound characterized by its complex structure, which includes an isoindole core. This compound features a tert-butyl group (1,1-dimethylethyl) that contributes to its hydrophobic properties, and a trifluoromethyl group that enhances its lipophilicity and may influence its reactivity and biological activity. The presence of a hydroxyl group indicates potential for hydrogen bonding, which can affect solubility and interaction with biological targets. The compound's molecular structure suggests it may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Its CAS number, 1242336-60-2, allows for precise identification in chemical databases. Overall, the unique combination of functional groups and structural features positions this compound as a potentially valuable substance in various chemical and pharmaceutical applications.
Formula:C13H14F3NO2
InChI:InChI=1S/C13H14F3NO2/c1-12(2,3)17-10(18)8-5-4-7(13(14,15)16)6-9(8)11(17)19/h4-6,10,18H,1-3H3
InChI key:InChIKey=VHSMYVDQIMNFGA-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(O)N1C(C)(C)C)=CC=C(C(F)(F)F)C2
Synonyms:- 1H-Isoindol-1-one, 2-(1,1-dimethylethyl)-2,3-dihydro-3-hydroxy-6-(trifluoromethyl)-
- 2-(1,1-Dimethylethyl)-2,3-dihydro-3-hydroxy-6-(trifluoromethyl)-1H-isoindol-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-t-Butyl-3-hydroxy-6-trifluoromethylisoindolin-1-one
CAS:Formula:C13H14F3NO2Molecular weight:273.2510
