
CAS 1242336-61-3
:Piperidine, 1-(3-bromo-5-fluorophenyl)-, hydrochloride (1:1)
Description:
Piperidine, 1-(3-bromo-5-fluorophenyl)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated heterocyclic amine. The presence of a 3-bromo-5-fluorophenyl group indicates that the compound has both bromine and fluorine substituents on the aromatic ring, which can influence its reactivity and biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The compound may exhibit properties such as being a potential intermediate in organic synthesis or having specific pharmacological effects, depending on its structure and substituents. Its molecular interactions can be influenced by the electronegative halogen atoms, which may affect the compound's lipophilicity and binding affinity to biological targets. Safety and handling precautions should be observed, as with any chemical substance, particularly those with halogenated groups, due to potential toxicity or environmental impact.
Formula:C11H13BrFN·ClH
InChI:InChI=1S/C11H13BrFN.ClH/c12-9-6-10(13)8-11(7-9)14-4-2-1-3-5-14;/h6-8H,1-5H2;1H
InChI key:InChIKey=HLKGOCKBYCONPS-UHFFFAOYSA-N
SMILES:BrC=1C=C(C=C(F)C1)N2CCCCC2.Cl
Synonyms:- Piperidine, 1-(3-bromo-5-fluorophenyl)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
