
CAS 1242336-67-9
:Pyridine, 5-bromo-2-(1-piperidinyl)-, hydrochloride (1:1)
Description:
Pyridine, 5-bromo-2-(1-piperidinyl)-, hydrochloride (1:1) is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a bromine atom at the 5-position and a piperidine group at the 2-position contributes to its unique reactivity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals and organic synthesis. The compound may exhibit properties such as basicity due to the nitrogen atom in the pyridine ring, and it can participate in nucleophilic substitution reactions. Its specific characteristics, such as melting point, boiling point, and spectral data, would depend on the purity and form of the compound. Overall, this substance is of interest in medicinal chemistry and may serve as a building block for the synthesis of more complex molecules.
Formula:C10H13BrN2·ClH
InChI:InChI=1S/C10H13BrN2.ClH/c11-9-4-5-10(12-8-9)13-6-2-1-3-7-13;/h4-5,8H,1-3,6-7H2;1H
InChI key:InChIKey=KOGSAJFBHIDONG-UHFFFAOYSA-N
SMILES:BrC1=CC=C(N=C1)N2CCCCC2.Cl
Synonyms:- Pyridine, 5-bromo-2-(1-piperidinyl)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
