CAS 1242336-71-5
:2-(2,4-Dichlorophenyl)oxazole
Description:
2-(2,4-Dichlorophenyl)oxazole is an organic compound characterized by its oxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen. The presence of the 2,4-dichlorophenyl group indicates that the compound has two chlorine substituents on the phenyl ring, specifically at the 2 and 4 positions, which can significantly influence its chemical properties, including reactivity and solubility. This compound is typically used in various chemical applications, including as an intermediate in the synthesis of pharmaceuticals or agrochemicals. Its molecular structure suggests potential biological activity, which may be explored in medicinal chemistry. The compound's physical properties, such as melting point, boiling point, and solubility, would depend on its specific interactions with solvents and other substances. Additionally, safety data should be considered, as halogenated compounds can exhibit toxicity or environmental persistence. Overall, 2-(2,4-Dichlorophenyl)oxazole represents a class of compounds with diverse applications in chemical research and industry.
Formula:C9H5Cl2NO
InChI:InChI=1S/C9H5Cl2NO/c10-6-1-2-7(8(11)5-6)9-12-3-4-13-9/h1-5H
InChI key:InChIKey=YWHOOKZYOXJCSH-UHFFFAOYSA-N
SMILES:ClC1=C(C2=NC=CO2)C=CC(Cl)=C1
Synonyms:- Oxazole, 2-(2,4-dichlorophenyl)-
- 2-(2,4-Dichlorophenyl)oxazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
