CAS 1242336-72-6
:1H-Pyrazole, 1-(2,6-dichlorophenyl)-
Description:
1H-Pyrazole, 1-(2,6-dichlorophenyl)- is an organic compound characterized by its pyrazole ring structure, which consists of a five-membered ring containing two adjacent nitrogen atoms. The presence of the 2,6-dichlorophenyl group indicates that the pyrazole is substituted with a phenyl ring that has chlorine atoms at the 2 and 6 positions, contributing to its chemical properties and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. The presence of chlorine atoms can enhance the compound's lipophilicity and influence its reactivity, making it of interest in medicinal chemistry. Additionally, the compound may exhibit specific interactions with biological targets, which could be explored for therapeutic purposes. Safety and handling precautions should be observed, as with many halogenated organic compounds, due to potential toxicity and environmental impact.
Formula:C9H6Cl2N2
InChI:InChI=1S/C9H6Cl2N2/c10-7-3-1-4-8(11)9(7)13-6-2-5-12-13/h1-6H
InChI key:InChIKey=ISWDZQBZQFCRIN-UHFFFAOYSA-N
SMILES:ClC1=C(C(Cl)=CC=C1)N2C=CC=N2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
