CAS 1242336-80-6

5-Amino-2-bromo-4-pyridinecarboxylic acid

Description:

5-Amino-2-bromo-4-pyridinecarboxylic acid is an organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. This compound features an amino group (-NH2) and a carboxylic acid group (-COOH) that contribute to its acidic properties and potential for hydrogen bonding. The presence of a bromine atom at the 2-position of the pyridine ring introduces halogen characteristics, which can influence the compound's reactivity and solubility. The molecular structure allows for various applications in pharmaceuticals and agrochemicals, particularly in the synthesis of biologically active molecules. Additionally, the compound's functional groups make it a candidate for further chemical modifications, enhancing its utility in research and development. Its solubility in polar solvents and stability under standard conditions are typical for similar pyridine derivatives, making it a valuable compound in organic synthesis and medicinal chemistry.

Formula: C₆H₅BrN₂O₂

InChI: InChI=1S/C6H5BrN2O2/c7-5-1-3(6(10)11)4(8)2-9-5/h1-2H,8H2,(H,10,11)

InChI key: InChIKey=TZANKVNNHOWWKK-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C(N)=CN=C(Br)C1

Synonyms:

• 5-Amino-2-bromo-4-pyridinecarboxylic acid
• 5-Amino-2-bromoisonicotinic acid
• 4-Pyridinecarboxylic acid, 5-amino-2-bromo-

4-Pyridinecarboxylic acid, 5-amino-2-bromo-

CAS: 1242336-80-6

Formula: C₆H₅BrN₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 217.0201

Ref: IN-DA000LQ2

5-Amino-2-bromoisonicotinic acid

CAS: 1242336-80-6

5-Amino-2-bromoisonicotinic acid

Purity: 95%

Molecular weight: 217.02g/mol

Ref: 54-OR91288

5-Amino-2-bromoisonicotinic acid

CAS: 1242336-80-6

Formula: C₆H₅BrN₂O₂

Purity: 95%

Color and Shape: Liquid, No data available.

Molecular weight: 217.022

Ref: 10-F233548