CAS 1242338-89-1

Piperidine, 4-[(4-methyl-1H-pyrazol-1-yl)methyl]-, hydrochloride (1:2)

Description:

Piperidine, 4-[(4-methyl-1H-pyrazol-1-yl)methyl]-, hydrochloride (1:2) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. The compound features a 4-methyl-1H-pyrazole moiety attached to the piperidine ring, indicating the presence of a pyrazole group that contributes to its biological activity and potential pharmacological properties. As a hydrochloride salt, it is typically more soluble in water, enhancing its utility in various applications, particularly in medicinal chemistry. The compound may exhibit properties such as being a potential ligand or a building block in drug development, given the structural diversity provided by the pyrazole substituent. Its molecular interactions can be influenced by the presence of the hydrochloride, which can affect its stability, solubility, and bioavailability. Overall, this compound is of interest in research contexts, particularly in the fields of organic synthesis and pharmacology.

Formula: C₁₀H₁₇N₃·2ClH

InChI: InChI=1S/C10H17N3.2ClH/c1-9-6-12-13(7-9)8-10-2-4-11-5-3-10;;/h6-7,10-11H,2-5,8H2,1H3;2*1H

InChI key: InChIKey=DQTSJYPJSZUOLH-UHFFFAOYSA-N

SMILES: C(N1N=CC(C)=C1)C2CCNCC2.Cl

Synonyms:

• Piperidine, 4-[(4-methyl-1H-pyrazol-1-yl)methyl]-, hydrochloride (1:2)