CAS 1242339-09-8

2′-Chloro-5′-nitro[1,1′-biphenyl]-3-carboxaldehyde

Description:

2′-Chloro-5′-nitro[1,1′-biphenyl]-3-carboxaldehyde is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a chloro group at the 2′ position and a nitro group at the 5′ position introduces significant electron-withdrawing characteristics, influencing the compound's reactivity and polarity. The carboxaldehyde functional group at the 3-position contributes to its potential as a reactive intermediate in various chemical reactions, including nucleophilic additions and condensation reactions. This compound may exhibit properties such as moderate solubility in organic solvents and potential applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals. Its specific reactivity and stability can be influenced by the substituents on the biphenyl framework, making it a subject of interest in synthetic organic chemistry. Safety and handling precautions should be observed due to the presence of halogen and nitro groups, which can impart toxicity and environmental concerns.

Formula: C₁₃H₈ClNO₃

InChI: InChI=1S/C13H8ClNO3/c14-13-5-4-11(15(17)18)7-12(13)10-3-1-2-9(6-10)8-16/h1-8H

InChI key: InChIKey=QMSREJGOWBGAFQ-UHFFFAOYSA-N

SMILES: ClC=1C(=CC(N(=O)=O)=CC1)C2=CC(C=O)=CC=C2

Synonyms:

• 2′-Chloro-5′-nitro[1,1′-biphenyl]-3-carboxaldehyde
• [1,1′-Biphenyl]-3-carboxaldehyde, 2′-chloro-5′-nitro-