CymitQuimica logo

CAS 1242339-24-7

:

2,4-Dichloro-6-fluorobenzenethiol

Description:
2,4-Dichloro-6-fluorobenzenethiol is an organosulfur compound characterized by the presence of a thiol (-SH) group attached to a benzene ring that is substituted with two chlorine atoms and one fluorine atom. This compound features a dichlorobenzene structure, indicating that two chlorine atoms are positioned at the 2 and 4 positions of the benzene ring, while a fluorine atom is located at the 6 position. The thiol group contributes to its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. The presence of halogen substituents can influence the compound's physical properties, such as solubility and boiling point, as well as its chemical behavior, including its reactivity and stability. Additionally, the compound may exhibit specific biological activities, which could be of interest in pharmaceutical or agrochemical applications. Safety data should be consulted for handling and potential hazards associated with this substance.
Formula:C6H3Cl2FS
InChI:InChI=1S/C6H3Cl2FS/c7-3-1-4(8)6(10)5(9)2-3/h1-2,10H
InChI key:InChIKey=LJMZYTYNKKXQJV-UHFFFAOYSA-N
SMILES:SC1=C(Cl)C=C(Cl)C=C1F
Synonyms:
  • 2,4-Dichloro-6-fluorobenzenethiol
  • Benzenethiol, 2,4-dichloro-6-fluoro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.